C10H17NS — CID 130290438
2-ethyl-4-pentyl-1,3-thiazole (PubChem CID 130290438) has the molecular formula C10H17NS and a molecular weight of 183.32 g/mol. Its IUPAC name is 2-ethyl-4-pentyl-1,3-thiazole.
| Compound Name | 2-ethyl-4-pentyl-1,3-thiazole |
|---|---|
| PubChem CID | 130290438 |
| Molecular Formula | C10H17NS |
| Molecular Weight | 183.32 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-ethyl-4-pentyl-1,3-thiazole |
| SMILES | CCCCCc1csc(CC)n1 |
| InChI | InChI=1S/C10H17NS/c1-3-5-6-7-9-8-12-10(4-2)11-9/h8H,3-7H2,1-2H3 |
| InChIKey | MVMTVUWKJZKZKQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|