C6H9NS2 — CID 39099702
(2-ethyl-1,3-thiazol-4-yl)methanethiol (PubChem CID 39099702) has the molecular formula C6H9NS2 and a molecular weight of 159.28 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-4-yl)methanethiol.
| Compound Name | (2-ethyl-1,3-thiazol-4-yl)methanethiol |
|---|---|
| PubChem CID | 39099702 |
| Molecular Formula | C6H9NS2 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.02 |
| IUPAC Name | (2-ethyl-1,3-thiazol-4-yl)methanethiol |
| SMILES | CCc1nc(CS)cs1 |
| InChI | InChI=1S/C6H9NS2/c1-2-6-7-5(3-8)4-9-6/h4,8H,2-3H2,1H3 |
| InChIKey | VVHOUFYVDGYIAJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|