C5H8N2S2 — CID 82502783
[2-(aminomethyl)-1,3-thiazol-4-yl]methanethiol (PubChem CID 82502783) has the molecular formula C5H8N2S2 and a molecular weight of 160.27 g/mol. Its IUPAC name is [2-(aminomethyl)-1,3-thiazol-4-yl]methanethiol.
| Compound Name | [2-(aminomethyl)-1,3-thiazol-4-yl]methanethiol |
|---|---|
| PubChem CID | 82502783 |
| Molecular Formula | C5H8N2S2 |
| Molecular Weight | 160.27 g/mol |
| Exact Mass | 160.01 |
| IUPAC Name | [2-(aminomethyl)-1,3-thiazol-4-yl]methanethiol |
| SMILES | NCc1nc(CS)cs1 |
| InChI | InChI=1S/C5H8N2S2/c6-1-5-7-4(2-8)3-9-5/h3,8H,1-2,6H2 |
| InChIKey | ZCTXXNZUSMFJML-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|