About (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride
(4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride (PubChem CID 44630590) has the molecular formula C4H6BrClN2S
and a molecular weight of 229.53 g/mol. Its IUPAC name is (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride.
Analyze (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride?
The IUPAC name of (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride (CID 44630590) is (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride.
What is the SMILES notation for (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride?
The canonical SMILES for (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride is Cl.NCc1nc(Br)cs1.
What is the InChIKey of (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride?
The InChIKey is GCYLPOFJYZDHDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5BrN2S.ClH/c5-3-2-8-4(1-6)7-3;/h2H,1,6H2;1H.
What are the key properties of (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride?
(4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride has a molecular weight of 229.53 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-1,3-thiazol-2-yl)methanamine;hydrochloride is sourced from PubChem (CID 44630590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).