C4H5IN2S — CID 148764752
(4-iodo-1,3-thiazol-2-yl)methanamine (PubChem CID 148764752) has the molecular formula C4H5IN2S and a molecular weight of 240.07 g/mol. Its IUPAC name is (4-iodo-1,3-thiazol-2-yl)methanamine.
| Compound Name | (4-iodo-1,3-thiazol-2-yl)methanamine |
|---|---|
| PubChem CID | 148764752 |
| Molecular Formula | C4H5IN2S |
| Molecular Weight | 240.07 g/mol |
| Exact Mass | 239.92 |
| IUPAC Name | (4-iodo-1,3-thiazol-2-yl)methanamine |
| SMILES | NCc1nc(I)cs1 |
| InChI | InChI=1S/C4H5IN2S/c5-3-2-8-4(1-6)7-3/h2H,1,6H2 |
| InChIKey | OHFYXOKIONAZAM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.07 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|