C7H8N2OS — CID 116585165
1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-2-en-1-one (PubChem CID 116585165) has the molecular formula C7H8N2OS and a molecular weight of 168.22 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-2-en-1-one.
| Compound Name | 1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 116585165 |
| Molecular Formula | C7H8N2OS |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | 1-[2-(aminomethyl)-1,3-thiazol-4-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1csc(CN)n1 |
| InChI | InChI=1S/C7H8N2OS/c1-2-6(10)5-4-11-7(3-8)9-5/h2,4H,1,3,8H2 |
| InChIKey | QOBROLHIZLJJJW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|