C12H18N2OS — CID 107010913
1-[2-(aminomethyl)-1,3-thiazol-4-yl]oct-7-en-1-one (PubChem CID 107010913) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-1,3-thiazol-4-yl]oct-7-en-1-one.
| Compound Name | 1-[2-(aminomethyl)-1,3-thiazol-4-yl]oct-7-en-1-one |
|---|---|
| PubChem CID | 107010913 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-[2-(aminomethyl)-1,3-thiazol-4-yl]oct-7-en-1-one |
| SMILES | C=CCCCCCC(=O)c1csc(CN)n1 |
| InChI | InChI=1S/C12H18N2OS/c1-2-3-4-5-6-7-11(15)10-9-16-12(8-13)14-10/h2,9H,1,3-8,13H2 |
| InChIKey | YEZIKUNXQISYLJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|