C11H6F5N3OS — CID 115564435
2-(aminomethyl)-N-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazole-4-carboxamide (PubChem CID 115564435) has the molecular formula C11H6F5N3OS and a molecular weight of 323.25 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(aminomethyl)-N-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 115564435 |
| Molecular Formula | C11H6F5N3OS |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-(aminomethyl)-N-(2,3,4,5,6-pentafluorophenyl)-1,3-thiazole-4-carboxamide |
| SMILES | NCc1nc(C(=O)Nc2c(F)c(F)c(F)c(F)c2F)cs1 |
| InChI | InChI=1S/C11H6F5N3OS/c12-5-6(13)8(15)10(9(16)7(5)14)19-11(20)3-2-21-4(1-17)18-3/h2H,1,17H2,(H,19,20) |
| InChIKey | YVOAYVIJMDXRBW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|