About (2-bromo-1,3-thiazol-4-yl)methanethiol
(2-bromo-1,3-thiazol-4-yl)methanethiol (PubChem CID 71650235) has the molecular formula C4H4BrNS2
and a molecular weight of 210.12 g/mol. Its IUPAC name is (2-bromo-1,3-thiazol-4-yl)methanethiol.
Molecular Properties
| Compound Name | (2-bromo-1,3-thiazol-4-yl)methanethiol |
| PubChem CID | 71650235 |
| Molecular Formula | C4H4BrNS2 |
| Molecular Weight | 210.12 g/mol |
| Exact Mass | 208.90 |
| IUPAC Name | (2-bromo-1,3-thiazol-4-yl)methanethiol |
| SMILES | SCc1csc(Br)n1 |
| InChI | InChI=1S/C4H4BrNS2/c5-4-6-3(1-7)2-8-4/h2,7H,1H2 |
| InChIKey | RARSMDFEZQPGMA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.12 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2-bromo-1,3-thiazol-4-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-1,3-thiazol-4-yl)methanethiol?
The IUPAC name of (2-bromo-1,3-thiazol-4-yl)methanethiol (CID 71650235) is (2-bromo-1,3-thiazol-4-yl)methanethiol.
What is the SMILES notation for (2-bromo-1,3-thiazol-4-yl)methanethiol?
The canonical SMILES for (2-bromo-1,3-thiazol-4-yl)methanethiol is SCc1csc(Br)n1.
What is the InChIKey of (2-bromo-1,3-thiazol-4-yl)methanethiol?
The InChIKey is RARSMDFEZQPGMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrNS2/c5-4-6-3(1-7)2-8-4/h2,7H,1H2.
What are the key properties of (2-bromo-1,3-thiazol-4-yl)methanethiol?
(2-bromo-1,3-thiazol-4-yl)methanethiol has a molecular weight of 210.12 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-1,3-thiazol-4-yl)methanethiol is sourced from PubChem (CID 71650235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).