C15H13NS2 — CID 39099748
[2-(naphthalen-1-ylmethyl)-1,3-thiazol-4-yl]methanethiol (PubChem CID 39099748) has the molecular formula C15H13NS2 and a molecular weight of 271.41 g/mol. Its IUPAC name is [2-(naphthalen-1-ylmethyl)-1,3-thiazol-4-yl]methanethiol.
| Compound Name | [2-(naphthalen-1-ylmethyl)-1,3-thiazol-4-yl]methanethiol |
|---|---|
| PubChem CID | 39099748 |
| Molecular Formula | C15H13NS2 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | [2-(naphthalen-1-ylmethyl)-1,3-thiazol-4-yl]methanethiol |
| SMILES | SCc1csc(Cc2cccc3ccccc23)n1 |
| InChI | InChI=1S/C15H13NS2/c17-9-13-10-18-15(16-13)8-12-6-3-5-11-4-1-2-7-14(11)12/h1-7,10,17H,8-9H2 |
| InChIKey | DAJCQTCEXUYYSD-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|