About 2-methylpropan-2-amine;naphthalen-1-ylmethanamine
2-methylpropan-2-amine;naphthalen-1-ylmethanamine (PubChem CID 142317452) has the molecular formula C15H22N2
and a molecular weight of 230.36 g/mol. Its IUPAC name is 2-methylpropan-2-amine;naphthalen-1-ylmethanamine.
Molecular Properties
| Compound Name | 2-methylpropan-2-amine;naphthalen-1-ylmethanamine |
| PubChem CID | 142317452 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-methylpropan-2-amine;naphthalen-1-ylmethanamine |
| SMILES | CC(C)(C)N.NCc1cccc2ccccc12 |
| InChI | InChI=1S/C11H11N.C4H11N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10;1-4(2,3)5/h1-7H,8,12H2;5H2,1-3H3 |
| InChIKey | SBTZUHVBDSIGQP-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylpropan-2-amine;naphthalen-1-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-2-amine;naphthalen-1-ylmethanamine?
The IUPAC name of 2-methylpropan-2-amine;naphthalen-1-ylmethanamine (CID 142317452) is 2-methylpropan-2-amine;naphthalen-1-ylmethanamine.
What is the SMILES notation for 2-methylpropan-2-amine;naphthalen-1-ylmethanamine?
The canonical SMILES for 2-methylpropan-2-amine;naphthalen-1-ylmethanamine is CC(C)(C)N.NCc1cccc2ccccc12.
What is the InChIKey of 2-methylpropan-2-amine;naphthalen-1-ylmethanamine?
The InChIKey is SBTZUHVBDSIGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N.C4H11N/c12-8-10-6-3-5-9-4-1-2-7-11(9)10;1-4(2,3)5/h1-7H,8,12H2;5H2,1-3H3.
What are the key properties of 2-methylpropan-2-amine;naphthalen-1-ylmethanamine?
2-methylpropan-2-amine;naphthalen-1-ylmethanamine has a molecular weight of 230.36 g/mol, XLogP of 3.04, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-2-amine;naphthalen-1-ylmethanamine is sourced from PubChem (CID 142317452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).