C15H17NO — CID 90911277
2,2-dimethyl-3-naphthalen-1-ylpropanamide (PubChem CID 90911277) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 2,2-dimethyl-3-naphthalen-1-ylpropanamide.
| Compound Name | 2,2-dimethyl-3-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 90911277 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2,2-dimethyl-3-naphthalen-1-ylpropanamide |
| SMILES | CC(C)(Cc1cccc2ccccc12)C(N)=O |
| InChI | InChI=1S/C15H17NO/c1-15(2,14(16)17)10-12-8-5-7-11-6-3-4-9-13(11)12/h3-9H,10H2,1-2H3,(H2,16,17) |
| InChIKey | KYHAOQUMLFWBDH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |