About carbamic acid;naphthalen-1-ylmethanol
carbamic acid;naphthalen-1-ylmethanol (PubChem CID 71402043) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is carbamic acid;naphthalen-1-ylmethanol.
Molecular Properties
| Compound Name | carbamic acid;naphthalen-1-ylmethanol |
| PubChem CID | 71402043 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | carbamic acid;naphthalen-1-ylmethanol |
| SMILES | NC(=O)O.OCc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10O.CH3NO2/c12-8-10-6-3-5-9-4-1-2-7-11(9)10;2-1(3)4/h1-7,12H,8H2;2H2,(H,3,4) |
| InChIKey | CEAUAYNKMYBFBZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze carbamic acid;naphthalen-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;naphthalen-1-ylmethanol?
The IUPAC name of carbamic acid;naphthalen-1-ylmethanol (CID 71402043) is carbamic acid;naphthalen-1-ylmethanol.
What is the SMILES notation for carbamic acid;naphthalen-1-ylmethanol?
The canonical SMILES for carbamic acid;naphthalen-1-ylmethanol is NC(=O)O.OCc1cccc2ccccc12.
What is the InChIKey of carbamic acid;naphthalen-1-ylmethanol?
The InChIKey is CEAUAYNKMYBFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O.CH3NO2/c12-8-10-6-3-5-9-4-1-2-7-11(9)10;2-1(3)4/h1-7,12H,8H2;2H2,(H,3,4).
What are the key properties of carbamic acid;naphthalen-1-ylmethanol?
carbamic acid;naphthalen-1-ylmethanol has a molecular weight of 219.24 g/mol, XLogP of 1.96, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;naphthalen-1-ylmethanol is sourced from PubChem (CID 71402043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).