About carbamic acid;perylene
carbamic acid;perylene (PubChem CID 22363514) has the molecular formula C21H15NO2
and a molecular weight of 313.36 g/mol. Its IUPAC name is carbamic acid;perylene.
Molecular Properties
| Compound Name | carbamic acid;perylene |
| PubChem CID | 22363514 |
| Molecular Formula | C21H15NO2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | carbamic acid;perylene |
| SMILES | NC(=O)O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.CH3NO2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;2-1(3)4/h1-12H;2H2,(H,3,4) |
| InChIKey | SPXXHUMCGNXBDD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;perylene?
The IUPAC name of carbamic acid;perylene (CID 22363514) is carbamic acid;perylene.
What is the SMILES notation for carbamic acid;perylene?
The canonical SMILES for carbamic acid;perylene is NC(=O)O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of carbamic acid;perylene?
The InChIKey is SPXXHUMCGNXBDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.CH3NO2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;2-1(3)4/h1-12H;2H2,(H,3,4).
What are the key properties of carbamic acid;perylene?
carbamic acid;perylene has a molecular weight of 313.36 g/mol, XLogP of 5.36, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;perylene is sourced from PubChem (CID 22363514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).