About perylene;phenol
perylene;phenol (PubChem CID 88796717) has the molecular formula C26H18O
and a molecular weight of 346.43 g/mol. Its IUPAC name is perylene;phenol.
Molecular Properties
| Compound Name | perylene;phenol |
| PubChem CID | 88796717 |
| Molecular Formula | C26H18O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | perylene;phenol |
| SMILES | Oc1ccccc1.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C6H6O/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;7-6-4-2-1-3-5-6/h1-12H;1-5,7H |
| InChIKey | OQYSMLDTDHYIMT-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze perylene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of perylene;phenol?
The IUPAC name of perylene;phenol (CID 88796717) is perylene;phenol.
What is the SMILES notation for perylene;phenol?
The canonical SMILES for perylene;phenol is Oc1ccccc1.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of perylene;phenol?
The InChIKey is OQYSMLDTDHYIMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C6H6O/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;7-6-4-2-1-3-5-6/h1-12H;1-5,7H.
What are the key properties of perylene;phenol?
perylene;phenol has a molecular weight of 346.43 g/mol, XLogP of 7.13, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for perylene;phenol is sourced from PubChem (CID 88796717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).