About 1-naphthalen-1-ylnaphthalene;phenol
1-naphthalen-1-ylnaphthalene;phenol (PubChem CID 174330284) has the molecular formula C32H26O2
and a molecular weight of 442.56 g/mol. Its IUPAC name is 1-naphthalen-1-ylnaphthalene;phenol.
Molecular Properties
| Compound Name | 1-naphthalen-1-ylnaphthalene;phenol |
| PubChem CID | 174330284 |
| Molecular Formula | C32H26O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 1-naphthalen-1-ylnaphthalene;phenol |
| SMILES | Oc1ccccc1.Oc1ccccc1.c1ccc2c(-c3cccc4ccccc34)cccc2c1 |
| InChI | InChI=1S/C20H14.2C6H6O/c1-3-11-17-15(7-1)9-5-13-19(17)20-14-6-10-16-8-2-4-12-18(16)20;2*7-6-4-2-1-3-5-6/h1-14H;2*1-5,7H |
| InChIKey | BVDNAVQFQYCEAA-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-naphthalen-1-ylnaphthalene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-naphthalen-1-ylnaphthalene;phenol?
The IUPAC name of 1-naphthalen-1-ylnaphthalene;phenol (CID 174330284) is 1-naphthalen-1-ylnaphthalene;phenol.
What is the SMILES notation for 1-naphthalen-1-ylnaphthalene;phenol?
The canonical SMILES for 1-naphthalen-1-ylnaphthalene;phenol is Oc1ccccc1.Oc1ccccc1.c1ccc2c(-c3cccc4ccccc34)cccc2c1.
What is the InChIKey of 1-naphthalen-1-ylnaphthalene;phenol?
The InChIKey is BVDNAVQFQYCEAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14.2C6H6O/c1-3-11-17-15(7-1)9-5-13-19(17)20-14-6-10-16-8-2-4-12-18(16)20;2*7-6-4-2-1-3-5-6/h1-14H;2*1-5,7H.
What are the key properties of 1-naphthalen-1-ylnaphthalene;phenol?
1-naphthalen-1-ylnaphthalene;phenol has a molecular weight of 442.56 g/mol, XLogP of 8.44, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-naphthalen-1-ylnaphthalene;phenol is sourced from PubChem (CID 174330284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).