About phenol;N-phenylnaphthalen-1-amine
phenol;N-phenylnaphthalen-1-amine (PubChem CID 159146578) has the molecular formula C22H19NO
and a molecular weight of 313.40 g/mol. Its IUPAC name is phenol;N-phenylnaphthalen-1-amine.
Molecular Properties
| Compound Name | phenol;N-phenylnaphthalen-1-amine |
| PubChem CID | 159146578 |
| Molecular Formula | C22H19NO |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | phenol;N-phenylnaphthalen-1-amine |
| SMILES | Oc1ccccc1.c1ccc(Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C16H13N.C6H6O/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16;7-6-4-2-1-3-5-6/h1-12,17H;1-5,7H |
| InChIKey | KITGDOSMUMHTCR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenol;N-phenylnaphthalen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;N-phenylnaphthalen-1-amine?
The IUPAC name of phenol;N-phenylnaphthalen-1-amine (CID 159146578) is phenol;N-phenylnaphthalen-1-amine.
What is the SMILES notation for phenol;N-phenylnaphthalen-1-amine?
The canonical SMILES for phenol;N-phenylnaphthalen-1-amine is Oc1ccccc1.c1ccc(Nc2cccc3ccccc23)cc1.
What is the InChIKey of phenol;N-phenylnaphthalen-1-amine?
The InChIKey is KITGDOSMUMHTCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N.C6H6O/c1-2-9-14(10-3-1)17-16-12-6-8-13-7-4-5-11-15(13)16;7-6-4-2-1-3-5-6/h1-12,17H;1-5,7H.
What are the key properties of phenol;N-phenylnaphthalen-1-amine?
phenol;N-phenylnaphthalen-1-amine has a molecular weight of 313.40 g/mol, XLogP of 5.98, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;N-phenylnaphthalen-1-amine is sourced from PubChem (CID 159146578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).