About acetic acid;perylene
acetic acid;perylene (PubChem CID 175230474) has the molecular formula C28H28O8
and a molecular weight of 492.52 g/mol. Its IUPAC name is acetic acid;perylene.
Molecular Properties
| Compound Name | acetic acid;perylene |
| PubChem CID | 175230474 |
| Molecular Formula | C28H28O8 |
| Molecular Weight | 492.52 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | acetic acid;perylene |
| SMILES | CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.4C2H4O2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;4*1-2(3)4/h1-12H;4*1H3,(H,3,4) |
| InChIKey | KYCLVIKTSHWBKT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;perylene?
The IUPAC name of acetic acid;perylene (CID 175230474) is acetic acid;perylene.
What is the SMILES notation for acetic acid;perylene?
The canonical SMILES for acetic acid;perylene is CC(=O)O.CC(=O)O.CC(=O)O.CC(=O)O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of acetic acid;perylene?
The InChIKey is KYCLVIKTSHWBKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.4C2H4O2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;4*1-2(3)4/h1-12H;4*1H3,(H,3,4).
What are the key properties of acetic acid;perylene?
acetic acid;perylene has a molecular weight of 492.52 g/mol, XLogP of 6.10, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;perylene is sourced from PubChem (CID 175230474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).