About ethane-1,2-diol;perylene
ethane-1,2-diol;perylene (PubChem CID 87614452) has the molecular formula C22H18O2
and a molecular weight of 314.38 g/mol. Its IUPAC name is ethane-1,2-diol;perylene.
Molecular Properties
| Compound Name | ethane-1,2-diol;perylene |
| PubChem CID | 87614452 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethane-1,2-diol;perylene |
| SMILES | OCCO.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C2H6O2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;3-1-2-4/h1-12H;3-4H,1-2H2 |
| InChIKey | VMXZNTQENGJHOC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diol;perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;perylene?
The IUPAC name of ethane-1,2-diol;perylene (CID 87614452) is ethane-1,2-diol;perylene.
What is the SMILES notation for ethane-1,2-diol;perylene?
The canonical SMILES for ethane-1,2-diol;perylene is OCCO.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of ethane-1,2-diol;perylene?
The InChIKey is VMXZNTQENGJHOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C2H6O2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;3-1-2-4/h1-12H;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;perylene?
ethane-1,2-diol;perylene has a molecular weight of 314.38 g/mol, XLogP of 4.71, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;perylene is sourced from PubChem (CID 87614452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).