C22H18O2 — CID 87614452
ethane-1,2-diol;perylene (PubChem CID 87614452) has the molecular formula C22H18O2 and a molecular weight of 314.38 g/mol. Its IUPAC name is ethane-1,2-diol;perylene.
| Compound Name | ethane-1,2-diol;perylene |
|---|---|
| PubChem CID | 87614452 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | ethane-1,2-diol;perylene |
| SMILES | OCCO.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C2H6O2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;3-1-2-4/h1-12H;3-4H,1-2H2 |
| InChIKey | VMXZNTQENGJHOC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|