About benzene-1,2-diol;perylene
benzene-1,2-diol;perylene (PubChem CID 175494116) has the molecular formula C26H18O2
and a molecular weight of 362.43 g/mol. Its IUPAC name is benzene-1,2-diol;perylene.
Molecular Properties
| Compound Name | benzene-1,2-diol;perylene |
| PubChem CID | 175494116 |
| Molecular Formula | C26H18O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | benzene-1,2-diol;perylene |
| SMILES | Oc1ccccc1O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54 |
| InChI | InChI=1S/C20H12.C6H6O2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;7-5-3-1-2-4-6(5)8/h1-12H;1-4,7-8H |
| InChIKey | VFQKFOAHGJTBOY-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;perylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;perylene?
The IUPAC name of benzene-1,2-diol;perylene (CID 175494116) is benzene-1,2-diol;perylene.
What is the SMILES notation for benzene-1,2-diol;perylene?
The canonical SMILES for benzene-1,2-diol;perylene is Oc1ccccc1O.c1cc2cccc3c4cccc5cccc(c(c1)c23)c54.
What is the InChIKey of benzene-1,2-diol;perylene?
The InChIKey is VFQKFOAHGJTBOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12.C6H6O2/c1-5-13-6-2-11-17-18-12-4-8-14-7-3-10-16(20(14)18)15(9-1)19(13)17;7-5-3-1-2-4-6(5)8/h1-12H;1-4,7-8H.
What are the key properties of benzene-1,2-diol;perylene?
benzene-1,2-diol;perylene has a molecular weight of 362.43 g/mol, XLogP of 6.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;perylene is sourced from PubChem (CID 175494116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).