About naphthalen-1-ol;zinc;hydrate
naphthalen-1-ol;zinc;hydrate (PubChem CID 175263139) has the molecular formula C10H10O2Zn
and a molecular weight of 227.58 g/mol. Its IUPAC name is naphthalen-1-ol;zinc;hydrate.
Molecular Properties
| Compound Name | naphthalen-1-ol;zinc;hydrate |
| PubChem CID | 175263139 |
| Molecular Formula | C10H10O2Zn |
| Molecular Weight | 227.58 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | naphthalen-1-ol;zinc;hydrate |
| SMILES | O.Oc1cccc2ccccc12.[Zn] |
| InChI | InChI=1S/C10H8O.H2O.Zn/c11-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7,11H;1H2; |
| InChIKey | BSVSNACCMRVVKY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.58 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-1-ol;zinc;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ol;zinc;hydrate?
The IUPAC name of naphthalen-1-ol;zinc;hydrate (CID 175263139) is naphthalen-1-ol;zinc;hydrate.
What is the SMILES notation for naphthalen-1-ol;zinc;hydrate?
The canonical SMILES for naphthalen-1-ol;zinc;hydrate is O.Oc1cccc2ccccc12.[Zn].
What is the InChIKey of naphthalen-1-ol;zinc;hydrate?
The InChIKey is BSVSNACCMRVVKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.H2O.Zn/c11-10-7-3-5-8-4-1-2-6-9(8)10;;/h1-7,11H;1H2;.
What are the key properties of naphthalen-1-ol;zinc;hydrate?
naphthalen-1-ol;zinc;hydrate has a molecular weight of 227.58 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ol;zinc;hydrate is sourced from PubChem (CID 175263139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).