About chloromethane;ethane;naphthalen-1-ol
chloromethane;ethane;naphthalen-1-ol (PubChem CID 144848699) has the molecular formula C15H23ClO
and a molecular weight of 254.80 g/mol. Its IUPAC name is chloromethane;ethane;naphthalen-1-ol.
Molecular Properties
| Compound Name | chloromethane;ethane;naphthalen-1-ol |
| PubChem CID | 144848699 |
| Molecular Formula | C15H23ClO |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | chloromethane;ethane;naphthalen-1-ol |
| SMILES | CC.CC.CCl.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O.2C2H6.CH3Cl/c11-10-7-3-5-8-4-1-2-6-9(8)10;3*1-2/h1-7,11H;2*1-2H3;1H3 |
| InChIKey | NAUANBBASJOXIN-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;ethane;naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;ethane;naphthalen-1-ol?
The IUPAC name of chloromethane;ethane;naphthalen-1-ol (CID 144848699) is chloromethane;ethane;naphthalen-1-ol.
What is the SMILES notation for chloromethane;ethane;naphthalen-1-ol?
The canonical SMILES for chloromethane;ethane;naphthalen-1-ol is CC.CC.CCl.Oc1cccc2ccccc12.
What is the InChIKey of chloromethane;ethane;naphthalen-1-ol?
The InChIKey is NAUANBBASJOXIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.2C2H6.CH3Cl/c11-10-7-3-5-8-4-1-2-6-9(8)10;3*1-2/h1-7,11H;2*1-2H3;1H3.
What are the key properties of chloromethane;ethane;naphthalen-1-ol?
chloromethane;ethane;naphthalen-1-ol has a molecular weight of 254.80 g/mol, XLogP of 5.45, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;ethane;naphthalen-1-ol is sourced from PubChem (CID 144848699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).