About butane;N-methylmethanamine;naphthalen-1-ol
butane;N-methylmethanamine;naphthalen-1-ol (PubChem CID 54239131) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is butane;N-methylmethanamine;naphthalen-1-ol.
Molecular Properties
| Compound Name | butane;N-methylmethanamine;naphthalen-1-ol |
| PubChem CID | 54239131 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | butane;N-methylmethanamine;naphthalen-1-ol |
| SMILES | CCCC.CNC.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O.C4H10.C2H7N/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-4-2;1-3-2/h1-7,11H;3-4H2,1-2H3;3H,1-2H3 |
| InChIKey | QOTHAYXSDQCQTH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;N-methylmethanamine;naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;N-methylmethanamine;naphthalen-1-ol?
The IUPAC name of butane;N-methylmethanamine;naphthalen-1-ol (CID 54239131) is butane;N-methylmethanamine;naphthalen-1-ol.
What is the SMILES notation for butane;N-methylmethanamine;naphthalen-1-ol?
The canonical SMILES for butane;N-methylmethanamine;naphthalen-1-ol is CCCC.CNC.Oc1cccc2ccccc12.
What is the InChIKey of butane;N-methylmethanamine;naphthalen-1-ol?
The InChIKey is QOTHAYXSDQCQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C4H10.C2H7N/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-4-2;1-3-2/h1-7,11H;3-4H2,1-2H3;3H,1-2H3.
What are the key properties of butane;N-methylmethanamine;naphthalen-1-ol?
butane;N-methylmethanamine;naphthalen-1-ol has a molecular weight of 247.38 g/mol, XLogP of 4.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;N-methylmethanamine;naphthalen-1-ol is sourced from PubChem (CID 54239131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).