About naphthalene;naphthalen-1-ol
naphthalene;naphthalen-1-ol (PubChem CID 174561564) has the molecular formula C30H24O
and a molecular weight of 400.52 g/mol. Its IUPAC name is naphthalene;naphthalen-1-ol.
Molecular Properties
| Compound Name | naphthalene;naphthalen-1-ol |
| PubChem CID | 174561564 |
| Molecular Formula | C30H24O |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | naphthalene;naphthalen-1-ol |
| SMILES | Oc1cccc2ccccc12.c1ccc2ccccc2c1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8O.2C10H8/c11-10-7-3-5-8-4-1-2-6-9(8)10;2*1-2-6-10-8-4-3-7-9(10)5-1/h1-7,11H;2*1-8H |
| InChIKey | ZXCBOOSSFDIEMK-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze naphthalene;naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;naphthalen-1-ol?
The IUPAC name of naphthalene;naphthalen-1-ol (CID 174561564) is naphthalene;naphthalen-1-ol.
What is the SMILES notation for naphthalene;naphthalen-1-ol?
The canonical SMILES for naphthalene;naphthalen-1-ol is Oc1cccc2ccccc12.c1ccc2ccccc2c1.c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;naphthalen-1-ol?
The InChIKey is ZXCBOOSSFDIEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.2C10H8/c11-10-7-3-5-8-4-1-2-6-9(8)10;2*1-2-6-10-8-4-3-7-9(10)5-1/h1-7,11H;2*1-8H.
What are the key properties of naphthalene;naphthalen-1-ol?
naphthalene;naphthalen-1-ol has a molecular weight of 400.52 g/mol, XLogP of 8.23, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;naphthalen-1-ol is sourced from PubChem (CID 174561564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).