About butane;naphthalen-1-ol
butane;naphthalen-1-ol (PubChem CID 142905950) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is butane;naphthalen-1-ol.
Molecular Properties
| Compound Name | butane;naphthalen-1-ol |
| PubChem CID | 142905950 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | butane;naphthalen-1-ol |
| SMILES | CCCC.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O.C4H10/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-4-2/h1-7,11H;3-4H2,1-2H3 |
| InChIKey | BBAABIHYHFXJEQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;naphthalen-1-ol?
The IUPAC name of butane;naphthalen-1-ol (CID 142905950) is butane;naphthalen-1-ol.
What is the SMILES notation for butane;naphthalen-1-ol?
The canonical SMILES for butane;naphthalen-1-ol is CCCC.Oc1cccc2ccccc12.
What is the InChIKey of butane;naphthalen-1-ol?
The InChIKey is BBAABIHYHFXJEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C4H10/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-4-2/h1-7,11H;3-4H2,1-2H3.
What are the key properties of butane;naphthalen-1-ol?
butane;naphthalen-1-ol has a molecular weight of 202.30 g/mol, XLogP of 4.35, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;naphthalen-1-ol is sourced from PubChem (CID 142905950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).