About naphthalen-1-ol;propanoic acid
naphthalen-1-ol;propanoic acid (PubChem CID 19792721) has the molecular formula C13H14O3
and a molecular weight of 218.25 g/mol. Its IUPAC name is naphthalen-1-ol;propanoic acid.
Molecular Properties
| Compound Name | naphthalen-1-ol;propanoic acid |
| PubChem CID | 19792721 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | naphthalen-1-ol;propanoic acid |
| SMILES | CCC(=O)O.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O.C3H6O2/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-3(4)5/h1-7,11H;2H2,1H3,(H,4,5) |
| InChIKey | DZHYBSISTCXMBN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze naphthalen-1-ol;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-ol;propanoic acid?
The IUPAC name of naphthalen-1-ol;propanoic acid (CID 19792721) is naphthalen-1-ol;propanoic acid.
What is the SMILES notation for naphthalen-1-ol;propanoic acid?
The canonical SMILES for naphthalen-1-ol;propanoic acid is CCC(=O)O.Oc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-ol;propanoic acid?
The InChIKey is DZHYBSISTCXMBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C3H6O2/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2-3(4)5/h1-7,11H;2H2,1H3,(H,4,5).
What are the key properties of naphthalen-1-ol;propanoic acid?
naphthalen-1-ol;propanoic acid has a molecular weight of 218.25 g/mol, XLogP of 3.03, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-ol;propanoic acid is sourced from PubChem (CID 19792721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).