About methylcarbamic acid;naphthalen-1-ol
methylcarbamic acid;naphthalen-1-ol (PubChem CID 53442833) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is methylcarbamic acid;naphthalen-1-ol.
Molecular Properties
| Compound Name | methylcarbamic acid;naphthalen-1-ol |
| PubChem CID | 53442833 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | methylcarbamic acid;naphthalen-1-ol |
| SMILES | CNC(=O)O.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O.C2H5NO2/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-2(4)5/h1-7,11H;3H,1H3,(H,4,5) |
| InChIKey | MMLXSAYZLUKQGO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methylcarbamic acid;naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcarbamic acid;naphthalen-1-ol?
The IUPAC name of methylcarbamic acid;naphthalen-1-ol (CID 53442833) is methylcarbamic acid;naphthalen-1-ol.
What is the SMILES notation for methylcarbamic acid;naphthalen-1-ol?
The canonical SMILES for methylcarbamic acid;naphthalen-1-ol is CNC(=O)O.Oc1cccc2ccccc12.
What is the InChIKey of methylcarbamic acid;naphthalen-1-ol?
The InChIKey is MMLXSAYZLUKQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.C2H5NO2/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-3-2(4)5/h1-7,11H;3H,1H3,(H,4,5).
What are the key properties of methylcarbamic acid;naphthalen-1-ol?
methylcarbamic acid;naphthalen-1-ol has a molecular weight of 219.24 g/mol, XLogP of 2.43, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylcarbamic acid;naphthalen-1-ol is sourced from PubChem (CID 53442833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).