C19H16O5 — CID 158292153
5-methylbenzene-1,3-dicarboxylic acid;naphthalen-1-ol (PubChem CID 158292153) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is 5-methylbenzene-1,3-dicarboxylic acid;naphthalen-1-ol.
| Compound Name | 5-methylbenzene-1,3-dicarboxylic acid;naphthalen-1-ol |
|---|---|
| PubChem CID | 158292153 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 5-methylbenzene-1,3-dicarboxylic acid;naphthalen-1-ol |
| SMILES | Cc1cc(C(=O)O)cc(C(=O)O)c1.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O.C9H8O4/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-5-2-6(8(10)11)4-7(3-5)9(12)13/h1-7,11H;2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | OXRWFHNJQZBIMX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |