C20H21NO4 — CID 174704003
methanamine;5-methylbenzene-1,3-dicarboxylic acid;naphthalene (PubChem CID 174704003) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is methanamine;5-methylbenzene-1,3-dicarboxylic acid;naphthalene.
| Compound Name | methanamine;5-methylbenzene-1,3-dicarboxylic acid;naphthalene |
|---|---|
| PubChem CID | 174704003 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | methanamine;5-methylbenzene-1,3-dicarboxylic acid;naphthalene |
| SMILES | CN.Cc1cc(C(=O)O)cc(C(=O)O)c1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.C9H8O4.CH5N/c1-2-6-10-8-4-3-7-9(10)5-1;1-5-2-6(8(10)11)4-7(3-5)9(12)13;1-2/h1-8H;2-4H,1H3,(H,10,11)(H,12,13);2H2,1H3 |
| InChIKey | KTIINRICOSYBCX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |