About anthracene;4-methylbenzoic acid
anthracene;4-methylbenzoic acid (PubChem CID 175030135) has the molecular formula C22H18O2
and a molecular weight of 314.38 g/mol. Its IUPAC name is anthracene;4-methylbenzoic acid.
Molecular Properties
| Compound Name | anthracene;4-methylbenzoic acid |
| PubChem CID | 175030135 |
| Molecular Formula | C22H18O2 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | anthracene;4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C8H8O2/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-6-2-4-7(5-3-6)8(9)10/h1-10H;2-5H,1H3,(H,9,10) |
| InChIKey | IGMSDAVKTKKUAF-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;4-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;4-methylbenzoic acid?
The IUPAC name of anthracene;4-methylbenzoic acid (CID 175030135) is anthracene;4-methylbenzoic acid.
What is the SMILES notation for anthracene;4-methylbenzoic acid?
The canonical SMILES for anthracene;4-methylbenzoic acid is Cc1ccc(C(=O)O)cc1.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;4-methylbenzoic acid?
The InChIKey is IGMSDAVKTKKUAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C8H8O2/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;1-6-2-4-7(5-3-6)8(9)10/h1-10H;2-5H,1H3,(H,9,10).
What are the key properties of anthracene;4-methylbenzoic acid?
anthracene;4-methylbenzoic acid has a molecular weight of 314.38 g/mol, XLogP of 5.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;4-methylbenzoic acid is sourced from PubChem (CID 175030135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).