About 4-methoxybenzoic acid;1-methoxy-4-methylbenzene
4-methoxybenzoic acid;1-methoxy-4-methylbenzene (PubChem CID 18916324) has the molecular formula C16H18O4
and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-methoxybenzoic acid;1-methoxy-4-methylbenzene.
Molecular Properties
| Compound Name | 4-methoxybenzoic acid;1-methoxy-4-methylbenzene |
| PubChem CID | 18916324 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-methoxybenzoic acid;1-methoxy-4-methylbenzene |
| SMILES | COc1ccc(C(=O)O)cc1.COc1ccc(C)cc1 |
| InChI | InChI=1S/C8H8O3.C8H10O/c1-11-7-4-2-6(3-5-7)8(9)10;1-7-3-5-8(9-2)6-4-7/h2-5H,1H3,(H,9,10);3-6H,1-2H3 |
| InChIKey | JKRMQZGLLDTEDY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxybenzoic acid;1-methoxy-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxybenzoic acid;1-methoxy-4-methylbenzene?
The IUPAC name of 4-methoxybenzoic acid;1-methoxy-4-methylbenzene (CID 18916324) is 4-methoxybenzoic acid;1-methoxy-4-methylbenzene.
What is the SMILES notation for 4-methoxybenzoic acid;1-methoxy-4-methylbenzene?
The canonical SMILES for 4-methoxybenzoic acid;1-methoxy-4-methylbenzene is COc1ccc(C(=O)O)cc1.COc1ccc(C)cc1.
What is the InChIKey of 4-methoxybenzoic acid;1-methoxy-4-methylbenzene?
The InChIKey is JKRMQZGLLDTEDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C8H10O/c1-11-7-4-2-6(3-5-7)8(9)10;1-7-3-5-8(9-2)6-4-7/h2-5H,1H3,(H,9,10);3-6H,1-2H3.
What are the key properties of 4-methoxybenzoic acid;1-methoxy-4-methylbenzene?
4-methoxybenzoic acid;1-methoxy-4-methylbenzene has a molecular weight of 274.32 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxybenzoic acid;1-methoxy-4-methylbenzene is sourced from PubChem (CID 18916324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).