C29H22O4 — CID 90306891
[4-[4-(4-methoxybenzoyl)benzoyl]phenyl]-(4-methylphenyl)methanone (PubChem CID 90306891) has the molecular formula C29H22O4 and a molecular weight of 434.49 g/mol. Its IUPAC name is [4-[4-(4-methoxybenzoyl)benzoyl]phenyl]-(4-methylphenyl)methanone.
| Compound Name | [4-[4-(4-methoxybenzoyl)benzoyl]phenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 90306891 |
| Molecular Formula | C29H22O4 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | [4-[4-(4-methoxybenzoyl)benzoyl]phenyl]-(4-methylphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2ccc(C(=O)c3ccc(C(=O)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H22O4/c1-19-3-5-20(6-4-19)27(30)21-7-9-22(10-8-21)28(31)23-11-13-24(14-12-23)29(32)25-15-17-26(33-2)18-16-25/h3-18H,1-2H3 |
| InChIKey | SWJMNGKZOIDUGQ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |