C28H22O4 — CID 58399730
(4-methoxyphenyl)-[3-[4-(4-methylphenoxy)benzoyl]phenyl]methanone (PubChem CID 58399730) has the molecular formula C28H22O4 and a molecular weight of 422.48 g/mol. Its IUPAC name is (4-methoxyphenyl)-[3-[4-(4-methylphenoxy)benzoyl]phenyl]methanone.
| Compound Name | (4-methoxyphenyl)-[3-[4-(4-methylphenoxy)benzoyl]phenyl]methanone |
|---|---|
| PubChem CID | 58399730 |
| Molecular Formula | C28H22O4 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | (4-methoxyphenyl)-[3-[4-(4-methylphenoxy)benzoyl]phenyl]methanone |
| SMILES | COc1ccc(C(=O)c2cccc(C(=O)c3ccc(Oc4ccc(C)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C28H22O4/c1-19-6-12-25(13-7-19)32-26-16-10-21(11-17-26)28(30)23-5-3-4-22(18-23)27(29)20-8-14-24(31-2)15-9-20/h3-18H,1-2H3 |
| InChIKey | DVFCTTFBIMIRQL-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |