C16H18O2 — CID 161368875
methane;(4-methoxyphenyl)-(4-methylphenyl)methanone (PubChem CID 161368875) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is methane;(4-methoxyphenyl)-(4-methylphenyl)methanone.
| Compound Name | methane;(4-methoxyphenyl)-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 161368875 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | methane;(4-methoxyphenyl)-(4-methylphenyl)methanone |
| SMILES | C.COc1ccc(C(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C15H14O2.CH4/c1-11-3-5-12(6-4-11)15(16)13-7-9-14(17-2)10-8-13;/h3-10H,1-2H3;1H4 |
| InChIKey | VQEVVAQWGCSBBM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |