C21H18O2 — CID 22389585
[4-(4-methylphenoxy)phenyl]-(4-methylphenyl)methanone (PubChem CID 22389585) has the molecular formula C21H18O2 and a molecular weight of 302.37 g/mol. Its IUPAC name is [4-(4-methylphenoxy)phenyl]-(4-methylphenyl)methanone.
| Compound Name | [4-(4-methylphenoxy)phenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 22389585 |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [4-(4-methylphenoxy)phenyl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(Oc2ccc(C(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H18O2/c1-15-3-7-17(8-4-15)21(22)18-9-13-20(14-10-18)23-19-11-5-16(2)6-12-19/h3-14H,1-2H3 |
| InChIKey | CEYYSMPBKHJBLH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |