C41H34O5 — CID 118474101
bis[4-[4-(3,5-dimethylphenoxy)phenoxy]phenyl]methanone (PubChem CID 118474101) has the molecular formula C41H34O5 and a molecular weight of 606.72 g/mol. Its IUPAC name is bis[4-[4-(3,5-dimethylphenoxy)phenoxy]phenyl]methanone.
| Compound Name | bis[4-[4-(3,5-dimethylphenoxy)phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 118474101 |
| Molecular Formula | C41H34O5 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | bis[4-[4-(3,5-dimethylphenoxy)phenoxy]phenyl]methanone |
| SMILES | Cc1cc(C)cc(Oc2ccc(Oc3ccc(C(=O)c4ccc(Oc5ccc(Oc6cc(C)cc(C)c6)cc5)cc4)cc3)cc2)c1 |
| InChI | InChI=1S/C41H34O5/c1-27-21-28(2)24-39(23-27)45-37-17-13-35(14-18-37)43-33-9-5-31(6-10-33)41(42)32-7-11-34(12-8-32)44-36-15-19-38(20-16-36)46-40-25-29(3)22-30(4)26-40/h5-26H,1-4H3 |
| InChIKey | GAFWNECOVVECBM-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |