C34H28O3 — CID 58983765
(4-methylphenyl)-[4-[4-[4-[(4-methylphenyl)methyl]phenoxy]phenoxy]phenyl]methanone (PubChem CID 58983765) has the molecular formula C34H28O3 and a molecular weight of 484.60 g/mol. Its IUPAC name is (4-methylphenyl)-[4-[4-[4-[(4-methylphenyl)methyl]phenoxy]phenoxy]phenyl]methanone.
| Compound Name | (4-methylphenyl)-[4-[4-[4-[(4-methylphenyl)methyl]phenoxy]phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 58983765 |
| Molecular Formula | C34H28O3 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | (4-methylphenyl)-[4-[4-[4-[(4-methylphenyl)methyl]phenoxy]phenoxy]phenyl]methanone |
| SMILES | Cc1ccc(Cc2ccc(Oc3ccc(Oc4ccc(C(=O)c5ccc(C)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H28O3/c1-24-3-7-26(8-4-24)23-27-9-15-30(16-10-27)36-32-19-21-33(22-20-32)37-31-17-13-29(14-18-31)34(35)28-11-5-25(2)6-12-28/h3-22H,23H2,1-2H3 |
| InChIKey | WLDLCPXYVQIGEC-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |