C28H24O3 — CID 20789588
(4-methoxyphenyl)-[4-[4-[(4-methylphenyl)methyl]phenoxy]phenyl]methanone (PubChem CID 20789588) has the molecular formula C28H24O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is (4-methoxyphenyl)-[4-[4-[(4-methylphenyl)methyl]phenoxy]phenyl]methanone.
| Compound Name | (4-methoxyphenyl)-[4-[4-[(4-methylphenyl)methyl]phenoxy]phenyl]methanone |
|---|---|
| PubChem CID | 20789588 |
| Molecular Formula | C28H24O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | (4-methoxyphenyl)-[4-[4-[(4-methylphenyl)methyl]phenoxy]phenyl]methanone |
| SMILES | COc1ccc(C(=O)c2ccc(Oc3ccc(Cc4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H24O3/c1-20-3-5-21(6-4-20)19-22-7-13-26(14-8-22)31-27-17-11-24(12-18-27)28(29)23-9-15-25(30-2)16-10-23/h3-18H,19H2,1-2H3 |
| InChIKey | SEKLTJNXQSTZNP-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |