C33H26O4S — CID 58021566
[4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-(4-methylphenyl)methanone (PubChem CID 58021566) has the molecular formula C33H26O4S and a molecular weight of 518.63 g/mol. Its IUPAC name is [4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-(4-methylphenyl)methanone.
| Compound Name | [4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 58021566 |
| Molecular Formula | C33H26O4S |
| Molecular Weight | 518.63 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | [4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2ccc(Oc3ccc(S(=O)(=O)c4ccc(Cc5ccccc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C33H26O4S/c1-24-7-11-27(12-8-24)33(34)28-13-15-29(16-14-28)37-30-17-21-32(22-18-30)38(35,36)31-19-9-26(10-20-31)23-25-5-3-2-4-6-25/h2-22H,23H2,1H3 |
| InChIKey | FOXZEEUETPOYNO-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |