C50H44F6O9S3 — CID 90830034
1-[4-[4-[2-[4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]sulfonyl-4-methylbenzene;ethane;methanesulfonic acid (PubChem CID 90830034) has the molecular formula C50H44F6O9S3 and a molecular weight of 999.08 g/mol. Its IUPAC name is 1-[4-[4-[2-[4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]sulfonyl-4-methylbenzene;ethane;methanesulfonic acid.
| Compound Name | 1-[4-[4-[2-[4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]sulfonyl-4-methylbenzene;ethane;methanesulfonic acid |
|---|---|
| PubChem CID | 90830034 |
| Molecular Formula | C50H44F6O9S3 |
| Molecular Weight | 999.08 g/mol |
| Exact Mass | 998.21 |
| IUPAC Name | 1-[4-[4-[2-[4-[4-(4-benzylphenyl)sulfonylphenoxy]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]phenyl]sulfonyl-4-methylbenzene;ethane;methanesulfonic acid |
| SMILES | CC.CS(=O)(=O)O.Cc1ccc(S(=O)(=O)c2ccc(Oc3ccc(C(c4ccc(Oc5ccc(S(=O)(=O)c6ccc(Cc7ccccc7)cc6)cc5)cc4)(C(F)(F)F)C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C47H34F6O6S2.C2H6.CH4O3S/c1-32-7-23-41(24-8-32)60(54,55)43-27-19-39(20-28-43)58-37-15-11-35(12-16-37)45(46(48,49)50,47(51,52)53)36-13-17-38(18-14-36)59-40-21-29-44(30-22-40)61(56,57)42-25-9-34(10-26-42)31-33-5-3-2-4-6-33;1-2;1-5(2,3)4/h2-30H,31H2,1H3;1-2H3;1H3,(H,2,3,4) |
| InChIKey | HWAQZYVQFBLGBN-UHFFFAOYSA-N |
| XLogP | 12.78 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.08 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|