C29H22F6O7S2 — CID 58214163
5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]-2-methoxybenzenesulfonic acid (PubChem CID 58214163) has the molecular formula C29H22F6O7S2 and a molecular weight of 660.61 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]-2-methoxybenzenesulfonic acid.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 58214163 |
| Molecular Formula | C29H22F6O7S2 |
| Molecular Weight | 660.61 g/mol |
| Exact Mass | 660.07 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylphenyl)sulfonylphenoxy]phenyl]propan-2-yl]-2-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(C(c2ccc(Oc3ccc(S(=O)(=O)c4ccc(C)cc4)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1S(=O)(=O)O |
| InChI | InChI=1S/C29H22F6O7S2/c1-18-3-12-23(13-4-18)43(36,37)24-14-10-22(11-15-24)42-21-8-5-19(6-9-21)27(28(30,31)32,29(33,34)35)20-7-16-25(41-2)26(17-20)44(38,39)40/h3-17H,1-2H3,(H,38,39,40) |
| InChIKey | ASXKOIJNYMKCCG-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.61 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|