C30H22F6O6S — CID 58214156
5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]propan-2-yl]-2-methoxybenzenesulfonic acid (PubChem CID 58214156) has the molecular formula C30H22F6O6S and a molecular weight of 624.56 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]propan-2-yl]-2-methoxybenzenesulfonic acid.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]propan-2-yl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 58214156 |
| Molecular Formula | C30H22F6O6S |
| Molecular Weight | 624.56 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-methylbenzoyl)phenoxy]phenyl]propan-2-yl]-2-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(C(c2ccc(Oc3ccc(C(=O)c4ccc(C)cc4)cc3)cc2)(C(F)(F)F)C(F)(F)F)cc1S(=O)(=O)O |
| InChI | InChI=1S/C30H22F6O6S/c1-18-3-5-19(6-4-18)27(37)20-7-12-23(13-8-20)42-24-14-9-21(10-15-24)28(29(31,32)33,30(34,35)36)22-11-16-25(41-2)26(17-22)43(38,39)40/h3-17H,1-2H3,(H,38,39,40) |
| InChIKey | YWFXJELSWIMJSM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.56 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|