C30H28O15S4 — CID 118444024
5-[2-[4-[4-(4-methoxy-3-sulfobenzoyl)-2-sulfophenoxy]-3-sulfophenyl]propan-2-yl]-2-methylbenzenesulfonic acid (PubChem CID 118444024) has the molecular formula C30H28O15S4 and a molecular weight of 756.81 g/mol. Its IUPAC name is 5-[2-[4-[4-(4-methoxy-3-sulfobenzoyl)-2-sulfophenoxy]-3-sulfophenyl]propan-2-yl]-2-methylbenzenesulfonic acid.
| Compound Name | 5-[2-[4-[4-(4-methoxy-3-sulfobenzoyl)-2-sulfophenoxy]-3-sulfophenyl]propan-2-yl]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 118444024 |
| Molecular Formula | C30H28O15S4 |
| Molecular Weight | 756.81 g/mol |
| Exact Mass | 756.03 |
| IUPAC Name | 5-[2-[4-[4-(4-methoxy-3-sulfobenzoyl)-2-sulfophenoxy]-3-sulfophenyl]propan-2-yl]-2-methylbenzenesulfonic acid |
| SMILES | COc1ccc(C(=O)c2ccc(Oc3ccc(C(C)(C)c4ccc(C)c(S(=O)(=O)O)c4)cc3S(=O)(=O)O)c(S(=O)(=O)O)c2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C30H28O15S4/c1-17-5-8-20(15-25(17)46(32,33)34)30(2,3)21-9-12-24(28(16-21)49(41,42)43)45-23-11-7-19(14-27(23)48(38,39)40)29(31)18-6-10-22(44-4)26(13-18)47(35,36)37/h5-16H,1-4H3,(H,32,33,34)(H,35,36,37)(H,38,39,40)(H,41,42,43) |
| InChIKey | SUMSGBKYYSDBRD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 253.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.81 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|