C45H34O12S3 — CID 118441009
2-methoxy-5-[4-[4-methyl-3,5-diphenyl-2,6-bis(4-sulfophenyl)phenoxy]benzoyl]benzenesulfonic acid (PubChem CID 118441009) has the molecular formula C45H34O12S3 and a molecular weight of 862.96 g/mol. Its IUPAC name is 2-methoxy-5-[4-[4-methyl-3,5-diphenyl-2,6-bis(4-sulfophenyl)phenoxy]benzoyl]benzenesulfonic acid.
| Compound Name | 2-methoxy-5-[4-[4-methyl-3,5-diphenyl-2,6-bis(4-sulfophenyl)phenoxy]benzoyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 118441009 |
| Molecular Formula | C45H34O12S3 |
| Molecular Weight | 862.96 g/mol |
| Exact Mass | 862.12 |
| IUPAC Name | 2-methoxy-5-[4-[4-methyl-3,5-diphenyl-2,6-bis(4-sulfophenyl)phenoxy]benzoyl]benzenesulfonic acid |
| SMILES | COc1ccc(C(=O)c2ccc(Oc3c(-c4ccc(S(=O)(=O)O)cc4)c(-c4ccccc4)c(C)c(-c4ccccc4)c3-c3ccc(S(=O)(=O)O)cc3)cc2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C45H34O12S3/c1-28-40(29-9-5-3-6-10-29)42(31-15-22-36(23-16-31)58(47,48)49)45(43(41(28)30-11-7-4-8-12-30)32-17-24-37(25-18-32)59(50,51)52)57-35-20-13-33(14-21-35)44(46)34-19-26-38(56-2)39(27-34)60(53,54)55/h3-27H,1-2H3,(H,47,48,49)(H,50,51,52)(H,53,54,55) |
| InChIKey | ZUMHLCZUYLTJOV-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.96 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|