C26H20O3 — CID 146206951
(4-methoxyphenyl)-[4-(4-phenylphenoxy)phenyl]methanone (PubChem CID 146206951) has the molecular formula C26H20O3 and a molecular weight of 380.44 g/mol. Its IUPAC name is (4-methoxyphenyl)-[4-(4-phenylphenoxy)phenyl]methanone.
| Compound Name | (4-methoxyphenyl)-[4-(4-phenylphenoxy)phenyl]methanone |
|---|---|
| PubChem CID | 146206951 |
| Molecular Formula | C26H20O3 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | (4-methoxyphenyl)-[4-(4-phenylphenoxy)phenyl]methanone |
| SMILES | COc1ccc(C(=O)c2ccc(Oc3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H20O3/c1-28-23-13-9-21(10-14-23)26(27)22-11-17-25(18-12-22)29-24-15-7-20(8-16-24)19-5-3-2-4-6-19/h2-18H,1H3 |
| InChIKey | IUIGFYDTMJIYFS-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |