C35H28O3 — CID 134955229
[4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-phenylmethanone (PubChem CID 134955229) has the molecular formula C35H28O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is [4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-phenylmethanone.
| Compound Name | [4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 134955229 |
| Molecular Formula | C35H28O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [4-[2,2-bis(4-methoxyphenyl)-1-phenylethenyl]phenyl]-phenylmethanone |
| SMILES | COc1ccc(C(=C(c2ccccc2)c2ccc(C(=O)c3ccccc3)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C35H28O3/c1-37-31-21-17-27(18-22-31)34(28-19-23-32(38-2)24-20-28)33(25-9-5-3-6-10-25)26-13-15-30(16-14-26)35(36)29-11-7-4-8-12-29/h3-24H,1-2H3 |
| InChIKey | HYRGSQUZLPIMEX-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|