C29H26O4 — CID 71403634
acetic acid;4-[1-(4-methoxyphenyl)-2,2-diphenylethenyl]phenol (PubChem CID 71403634) has the molecular formula C29H26O4 and a molecular weight of 438.52 g/mol. Its IUPAC name is acetic acid;4-[1-(4-methoxyphenyl)-2,2-diphenylethenyl]phenol.
| Compound Name | acetic acid;4-[1-(4-methoxyphenyl)-2,2-diphenylethenyl]phenol |
|---|---|
| PubChem CID | 71403634 |
| Molecular Formula | C29H26O4 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | acetic acid;4-[1-(4-methoxyphenyl)-2,2-diphenylethenyl]phenol |
| SMILES | CC(=O)O.COc1ccc(C(=C(c2ccccc2)c2ccccc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C27H22O2.C2H4O2/c1-29-25-18-14-23(15-19-25)27(22-12-16-24(28)17-13-22)26(20-8-4-2-5-9-20)21-10-6-3-7-11-21;1-2(3)4/h2-19,28H,1H3;1H3,(H,3,4) |
| InChIKey | YCRQUZBEVOTWPA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|