C13H14O4 — CID 70292826
benzene-1,2-diol;4-methoxyphenol (PubChem CID 70292826) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is benzene-1,2-diol;4-methoxyphenol.
| Compound Name | benzene-1,2-diol;4-methoxyphenol |
|---|---|
| PubChem CID | 70292826 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | benzene-1,2-diol;4-methoxyphenol |
| SMILES | COc1ccc(O)cc1.Oc1ccccc1O |
| InChI | InChI=1S/C7H8O2.C6H6O2/c1-9-7-4-2-6(8)3-5-7;7-5-3-1-2-4-6(5)8/h2-5,8H,1H3;1-4,7-8H |
| InChIKey | KXCHGYVTANEYBB-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|