About cyanic acid;4-methoxyphenol
cyanic acid;4-methoxyphenol (PubChem CID 172812844) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is cyanic acid;4-methoxyphenol.
Molecular Properties
| Compound Name | cyanic acid;4-methoxyphenol |
| PubChem CID | 172812844 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | cyanic acid;4-methoxyphenol |
| SMILES | COc1ccc(O)cc1.N#CO |
| InChI | InChI=1S/C7H8O2.CHNO/c1-9-7-4-2-6(8)3-5-7;2-1-3/h2-5,8H,1H3;3H |
| InChIKey | SKMJEIUOKAZCQN-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze cyanic acid;4-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanic acid;4-methoxyphenol?
The IUPAC name of cyanic acid;4-methoxyphenol (CID 172812844) is cyanic acid;4-methoxyphenol.
What is the SMILES notation for cyanic acid;4-methoxyphenol?
The canonical SMILES for cyanic acid;4-methoxyphenol is COc1ccc(O)cc1.N#CO.
What is the InChIKey of cyanic acid;4-methoxyphenol?
The InChIKey is SKMJEIUOKAZCQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.CHNO/c1-9-7-4-2-6(8)3-5-7;2-1-3/h2-5,8H,1H3;3H.
What are the key properties of cyanic acid;4-methoxyphenol?
cyanic acid;4-methoxyphenol has a molecular weight of 167.16 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanic acid;4-methoxyphenol is sourced from PubChem (CID 172812844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).