About methane;4-methoxyphenol
methane;4-methoxyphenol (PubChem CID 159494332) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is methane;4-methoxyphenol.
Molecular Properties
| Compound Name | methane;4-methoxyphenol |
| PubChem CID | 159494332 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | methane;4-methoxyphenol |
| SMILES | C.COc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8O2.CH4/c1-9-7-4-2-6(8)3-5-7;/h2-5,8H,1H3;1H4 |
| InChIKey | LYOZLSGXEOQWSJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;4-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;4-methoxyphenol?
The IUPAC name of methane;4-methoxyphenol (CID 159494332) is methane;4-methoxyphenol.
What is the SMILES notation for methane;4-methoxyphenol?
The canonical SMILES for methane;4-methoxyphenol is C.COc1ccc(O)cc1.
What is the InChIKey of methane;4-methoxyphenol?
The InChIKey is LYOZLSGXEOQWSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.CH4/c1-9-7-4-2-6(8)3-5-7;/h2-5,8H,1H3;1H4.
What are the key properties of methane;4-methoxyphenol?
methane;4-methoxyphenol has a molecular weight of 140.18 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;4-methoxyphenol is sourced from PubChem (CID 159494332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).